C24H34N4O3S2 — CID 33139402
N-[3-(4-phenylpiperazin-1-yl)propyl]-2-(5-piperidin-1-ylsulfonylthiophen-2-yl)acetamide (PubChem CID 33139402) has the molecular formula C24H34N4O3S2 and a molecular weight of 490.70 g/mol. Its IUPAC name is N-[3-(4-phenylpiperazin-1-yl)propyl]-2-(5-piperidin-1-ylsulfonylthiophen-2-yl)acetamide.
| Compound Name | N-[3-(4-phenylpiperazin-1-yl)propyl]-2-(5-piperidin-1-ylsulfonylthiophen-2-yl)acetamide |
|---|---|
| PubChem CID | 33139402 |
| Molecular Formula | C24H34N4O3S2 |
| Molecular Weight | 490.70 g/mol |
| Exact Mass | 490.21 |
| IUPAC Name | N-[3-(4-phenylpiperazin-1-yl)propyl]-2-(5-piperidin-1-ylsulfonylthiophen-2-yl)acetamide |
| SMILES | O=C(Cc1ccc(S(=O)(=O)N2CCCCC2)s1)NCCCN1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C24H34N4O3S2/c29-23(20-22-10-11-24(32-22)33(30,31)28-14-5-2-6-15-28)25-12-7-13-26-16-18-27(19-17-26)21-8-3-1-4-9-21/h1,3-4,8-11H,2,5-7,12-20H2,(H,25,29) |
| InChIKey | QMGRRQUPKOKVKZ-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.70 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|