C21H30N2O3S2 — CID 26202930
N-(1-adamantylmethyl)-2-(5-pyrrolidin-1-ylsulfonylthiophen-2-yl)acetamide (PubChem CID 26202930) has the molecular formula C21H30N2O3S2 and a molecular weight of 422.62 g/mol. Its IUPAC name is N-(1-adamantylmethyl)-2-(5-pyrrolidin-1-ylsulfonylthiophen-2-yl)acetamide.
| Compound Name | N-(1-adamantylmethyl)-2-(5-pyrrolidin-1-ylsulfonylthiophen-2-yl)acetamide |
|---|---|
| PubChem CID | 26202930 |
| Molecular Formula | C21H30N2O3S2 |
| Molecular Weight | 422.62 g/mol |
| Exact Mass | 422.17 |
| IUPAC Name | N-(1-adamantylmethyl)-2-(5-pyrrolidin-1-ylsulfonylthiophen-2-yl)acetamide |
| SMILES | O=C(Cc1ccc(S(=O)(=O)N2CCCC2)s1)NCC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C21H30N2O3S2/c24-19(22-14-21-11-15-7-16(12-21)9-17(8-15)13-21)10-18-3-4-20(27-18)28(25,26)23-5-1-2-6-23/h3-4,15-17H,1-2,5-14H2,(H,22,24) |
| InChIKey | FJVILDFRTQMVNA-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.62 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |