C14H21N3O3S2 — CID 119451561
N-pyrrolidin-3-yl-2-(5-pyrrolidin-1-ylsulfonylthiophen-2-yl)acetamide (PubChem CID 119451561) has the molecular formula C14H21N3O3S2 and a molecular weight of 343.47 g/mol. Its IUPAC name is N-pyrrolidin-3-yl-2-(5-pyrrolidin-1-ylsulfonylthiophen-2-yl)acetamide.
| Compound Name | N-pyrrolidin-3-yl-2-(5-pyrrolidin-1-ylsulfonylthiophen-2-yl)acetamide |
|---|---|
| PubChem CID | 119451561 |
| Molecular Formula | C14H21N3O3S2 |
| Molecular Weight | 343.47 g/mol |
| Exact Mass | 343.10 |
| IUPAC Name | N-pyrrolidin-3-yl-2-(5-pyrrolidin-1-ylsulfonylthiophen-2-yl)acetamide |
| SMILES | O=C(Cc1ccc(S(=O)(=O)N2CCCC2)s1)NC1CCNC1 |
| InChI | InChI=1S/C14H21N3O3S2/c18-13(16-11-5-6-15-10-11)9-12-3-4-14(21-12)22(19,20)17-7-1-2-8-17/h3-4,11,15H,1-2,5-10H2,(H,16,18) |
| InChIKey | PLPJBYNUPDLFDK-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.47 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |