C20H30N2O3S2 — CID 47024589
N-cyclohexyl-N-cyclopropyl-2-(5-piperidin-1-ylsulfonylthiophen-2-yl)acetamide (PubChem CID 47024589) has the molecular formula C20H30N2O3S2 and a molecular weight of 410.61 g/mol. Its IUPAC name is N-cyclohexyl-N-cyclopropyl-2-(5-piperidin-1-ylsulfonylthiophen-2-yl)acetamide.
| Compound Name | N-cyclohexyl-N-cyclopropyl-2-(5-piperidin-1-ylsulfonylthiophen-2-yl)acetamide |
|---|---|
| PubChem CID | 47024589 |
| Molecular Formula | C20H30N2O3S2 |
| Molecular Weight | 410.61 g/mol |
| Exact Mass | 410.17 |
| IUPAC Name | N-cyclohexyl-N-cyclopropyl-2-(5-piperidin-1-ylsulfonylthiophen-2-yl)acetamide |
| SMILES | O=C(Cc1ccc(S(=O)(=O)N2CCCCC2)s1)N(C1CCCCC1)C1CC1 |
| InChI | InChI=1S/C20H30N2O3S2/c23-19(22(17-9-10-17)16-7-3-1-4-8-16)15-18-11-12-20(26-18)27(24,25)21-13-5-2-6-14-21/h11-12,16-17H,1-10,13-15H2 |
| InChIKey | SLWIVHMGRGGQBS-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.61 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |