C17H19NO4S2 — CID 8765493
phenyl 2-(5-piperidin-1-ylsulfonylthiophen-2-yl)acetate (PubChem CID 8765493) has the molecular formula C17H19NO4S2 and a molecular weight of 365.48 g/mol. Its IUPAC name is phenyl 2-(5-piperidin-1-ylsulfonylthiophen-2-yl)acetate.
| Compound Name | phenyl 2-(5-piperidin-1-ylsulfonylthiophen-2-yl)acetate |
|---|---|
| PubChem CID | 8765493 |
| Molecular Formula | C17H19NO4S2 |
| Molecular Weight | 365.48 g/mol |
| Exact Mass | 365.08 |
| IUPAC Name | phenyl 2-(5-piperidin-1-ylsulfonylthiophen-2-yl)acetate |
| SMILES | O=C(Cc1ccc(S(=O)(=O)N2CCCCC2)s1)Oc1ccccc1 |
| InChI | InChI=1S/C17H19NO4S2/c19-16(22-14-7-3-1-4-8-14)13-15-9-10-17(23-15)24(20,21)18-11-5-2-6-12-18/h1,3-4,7-10H,2,5-6,11-13H2 |
| InChIKey | IKCTXRIWGPSTJI-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.48 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|