C25H28N2O3S2 — CID 31821793
N-benzyl-N-(2-phenylethyl)-2-(5-pyrrolidin-1-ylsulfonylthiophen-2-yl)acetamide (PubChem CID 31821793) has the molecular formula C25H28N2O3S2 and a molecular weight of 468.64 g/mol. Its IUPAC name is N-benzyl-N-(2-phenylethyl)-2-(5-pyrrolidin-1-ylsulfonylthiophen-2-yl)acetamide.
| Compound Name | N-benzyl-N-(2-phenylethyl)-2-(5-pyrrolidin-1-ylsulfonylthiophen-2-yl)acetamide |
|---|---|
| PubChem CID | 31821793 |
| Molecular Formula | C25H28N2O3S2 |
| Molecular Weight | 468.64 g/mol |
| Exact Mass | 468.15 |
| IUPAC Name | N-benzyl-N-(2-phenylethyl)-2-(5-pyrrolidin-1-ylsulfonylthiophen-2-yl)acetamide |
| SMILES | O=C(Cc1ccc(S(=O)(=O)N2CCCC2)s1)N(CCc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C25H28N2O3S2/c28-24(19-23-13-14-25(31-23)32(29,30)27-16-7-8-17-27)26(20-22-11-5-2-6-12-22)18-15-21-9-3-1-4-10-21/h1-6,9-14H,7-8,15-20H2 |
| InChIKey | GFDJDCBBSQRTPE-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.64 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |