C27H30N2O3S — CID 24980279
N-benzyl-N-(2-phenylethyl)-3-piperidin-1-ylsulfonylbenzamide (PubChem CID 24980279) has the molecular formula C27H30N2O3S and a molecular weight of 462.62 g/mol. Its IUPAC name is N-benzyl-N-(2-phenylethyl)-3-piperidin-1-ylsulfonylbenzamide.
| Compound Name | N-benzyl-N-(2-phenylethyl)-3-piperidin-1-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 24980279 |
| Molecular Formula | C27H30N2O3S |
| Molecular Weight | 462.62 g/mol |
| Exact Mass | 462.20 |
| IUPAC Name | N-benzyl-N-(2-phenylethyl)-3-piperidin-1-ylsulfonylbenzamide |
| SMILES | O=C(c1cccc(S(=O)(=O)N2CCCCC2)c1)N(CCc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C27H30N2O3S/c30-27(25-15-10-16-26(21-25)33(31,32)29-18-8-3-9-19-29)28(22-24-13-6-2-7-14-24)20-17-23-11-4-1-5-12-23/h1-2,4-7,10-16,21H,3,8-9,17-20,22H2 |
| InChIKey | BZJRFBJPXAQAKP-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.62 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |