C24H29N3O6S — CID 55514492
methyl 3-[[3-(4-acetylpiperazin-1-yl)sulfonylbenzoyl]-benzylamino]propanoate (PubChem CID 55514492) has the molecular formula C24H29N3O6S and a molecular weight of 487.58 g/mol. Its IUPAC name is methyl 3-[[3-(4-acetylpiperazin-1-yl)sulfonylbenzoyl]-benzylamino]propanoate.
| Compound Name | methyl 3-[[3-(4-acetylpiperazin-1-yl)sulfonylbenzoyl]-benzylamino]propanoate |
|---|---|
| PubChem CID | 55514492 |
| Molecular Formula | C24H29N3O6S |
| Molecular Weight | 487.58 g/mol |
| Exact Mass | 487.18 |
| IUPAC Name | methyl 3-[[3-(4-acetylpiperazin-1-yl)sulfonylbenzoyl]-benzylamino]propanoate |
| SMILES | COC(=O)CCN(Cc1ccccc1)C(=O)c1cccc(S(=O)(=O)N2CCN(C(C)=O)CC2)c1 |
| InChI | InChI=1S/C24H29N3O6S/c1-19(28)25-13-15-27(16-14-25)34(31,32)22-10-6-9-21(17-22)24(30)26(12-11-23(29)33-2)18-20-7-4-3-5-8-20/h3-10,17H,11-16,18H2,1-2H3 |
| InChIKey | HOWUYBWQIINEAM-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 104.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.58 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |