C22H27N3O3S — CID 55549426
N-benzyl-N-cyclopropyl-3-(4-methylpiperazin-1-yl)sulfonylbenzamide (PubChem CID 55549426) has the molecular formula C22H27N3O3S and a molecular weight of 413.54 g/mol. Its IUPAC name is N-benzyl-N-cyclopropyl-3-(4-methylpiperazin-1-yl)sulfonylbenzamide.
| Compound Name | N-benzyl-N-cyclopropyl-3-(4-methylpiperazin-1-yl)sulfonylbenzamide |
|---|---|
| PubChem CID | 55549426 |
| Molecular Formula | C22H27N3O3S |
| Molecular Weight | 413.54 g/mol |
| Exact Mass | 413.18 |
| IUPAC Name | N-benzyl-N-cyclopropyl-3-(4-methylpiperazin-1-yl)sulfonylbenzamide |
| SMILES | CN1CCN(S(=O)(=O)c2cccc(C(=O)N(Cc3ccccc3)C3CC3)c2)CC1 |
| InChI | InChI=1S/C22H27N3O3S/c1-23-12-14-24(15-13-23)29(27,28)21-9-5-8-19(16-21)22(26)25(20-10-11-20)17-18-6-3-2-4-7-18/h2-9,16,20H,10-15,17H2,1H3 |
| InChIKey | IXJSAHBDKOLZMI-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.54 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |