C28H33N3O3S — CID 60616235
N-[[1-(benzenesulfonyl)piperidin-4-yl]methyl]-3-[[benzyl(methyl)amino]methyl]benzamide (PubChem CID 60616235) has the molecular formula C28H33N3O3S and a molecular weight of 491.66 g/mol. Its IUPAC name is N-[[1-(benzenesulfonyl)piperidin-4-yl]methyl]-3-[[benzyl(methyl)amino]methyl]benzamide.
| Compound Name | N-[[1-(benzenesulfonyl)piperidin-4-yl]methyl]-3-[[benzyl(methyl)amino]methyl]benzamide |
|---|---|
| PubChem CID | 60616235 |
| Molecular Formula | C28H33N3O3S |
| Molecular Weight | 491.66 g/mol |
| Exact Mass | 491.22 |
| IUPAC Name | N-[[1-(benzenesulfonyl)piperidin-4-yl]methyl]-3-[[benzyl(methyl)amino]methyl]benzamide |
| SMILES | CN(Cc1ccccc1)Cc1cccc(C(=O)NCC2CCN(S(=O)(=O)c3ccccc3)CC2)c1 |
| InChI | InChI=1S/C28H33N3O3S/c1-30(21-24-9-4-2-5-10-24)22-25-11-8-12-26(19-25)28(32)29-20-23-15-17-31(18-16-23)35(33,34)27-13-6-3-7-14-27/h2-14,19,23H,15-18,20-22H2,1H3,(H,29,32) |
| InChIKey | ZTEDOXAUMRHVQR-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.66 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |