C20H26N2O2S — CID 119123184
1-[1-(benzenesulfonyl)piperidin-4-yl]-N-[(3-methylphenyl)methyl]methanamine (PubChem CID 119123184) has the molecular formula C20H26N2O2S and a molecular weight of 358.51 g/mol. Its IUPAC name is 1-[1-(benzenesulfonyl)piperidin-4-yl]-N-[(3-methylphenyl)methyl]methanamine.
| Compound Name | 1-[1-(benzenesulfonyl)piperidin-4-yl]-N-[(3-methylphenyl)methyl]methanamine |
|---|---|
| PubChem CID | 119123184 |
| Molecular Formula | C20H26N2O2S |
| Molecular Weight | 358.51 g/mol |
| Exact Mass | 358.17 |
| IUPAC Name | 1-[1-(benzenesulfonyl)piperidin-4-yl]-N-[(3-methylphenyl)methyl]methanamine |
| SMILES | Cc1cccc(CNCC2CCN(S(=O)(=O)c3ccccc3)CC2)c1 |
| InChI | InChI=1S/C20H26N2O2S/c1-17-6-5-7-19(14-17)16-21-15-18-10-12-22(13-11-18)25(23,24)20-8-3-2-4-9-20/h2-9,14,18,21H,10-13,15-16H2,1H3 |
| InChIKey | RWRBCUUTXSXSGD-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.51 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |