C26H29NO2S — CID 46087013
1-(3-methylphenyl)sulfonyl-4-[2-(4-phenylphenyl)ethyl]piperidine (PubChem CID 46087013) has the molecular formula C26H29NO2S and a molecular weight of 419.59 g/mol. Its IUPAC name is 1-(3-methylphenyl)sulfonyl-4-[2-(4-phenylphenyl)ethyl]piperidine.
| Compound Name | 1-(3-methylphenyl)sulfonyl-4-[2-(4-phenylphenyl)ethyl]piperidine |
|---|---|
| PubChem CID | 46087013 |
| Molecular Formula | C26H29NO2S |
| Molecular Weight | 419.59 g/mol |
| Exact Mass | 419.19 |
| IUPAC Name | 1-(3-methylphenyl)sulfonyl-4-[2-(4-phenylphenyl)ethyl]piperidine |
| SMILES | Cc1cccc(S(=O)(=O)N2CCC(CCc3ccc(-c4ccccc4)cc3)CC2)c1 |
| InChI | InChI=1S/C26H29NO2S/c1-21-6-5-9-26(20-21)30(28,29)27-18-16-23(17-19-27)11-10-22-12-14-25(15-13-22)24-7-3-2-4-8-24/h2-9,12-15,20,23H,10-11,16-19H2,1H3 |
| InChIKey | PMMNABCOVFNDTG-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.59 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |