C20H32N2O2S — CID 52552627
1-[4-[2-(4-methylphenyl)ethyl]piperidin-1-yl]sulfonylazepane (PubChem CID 52552627) has the molecular formula C20H32N2O2S and a molecular weight of 364.56 g/mol. Its IUPAC name is 1-[4-[2-(4-methylphenyl)ethyl]piperidin-1-yl]sulfonylazepane.
| Compound Name | 1-[4-[2-(4-methylphenyl)ethyl]piperidin-1-yl]sulfonylazepane |
|---|---|
| PubChem CID | 52552627 |
| Molecular Formula | C20H32N2O2S |
| Molecular Weight | 364.56 g/mol |
| Exact Mass | 364.22 |
| IUPAC Name | 1-[4-[2-(4-methylphenyl)ethyl]piperidin-1-yl]sulfonylazepane |
| SMILES | Cc1ccc(CCC2CCN(S(=O)(=O)N3CCCCCC3)CC2)cc1 |
| InChI | InChI=1S/C20H32N2O2S/c1-18-6-8-19(9-7-18)10-11-20-12-16-22(17-13-20)25(23,24)21-14-4-2-3-5-15-21/h6-9,20H,2-5,10-17H2,1H3 |
| InChIKey | BILLUJSKYMFONJ-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.56 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |