C25H27NO2S — CID 46086776
1-(benzenesulfonyl)-4-[2-(4-phenylphenyl)ethyl]piperidine (PubChem CID 46086776) has the molecular formula C25H27NO2S and a molecular weight of 405.56 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-4-[2-(4-phenylphenyl)ethyl]piperidine.
| Compound Name | 1-(benzenesulfonyl)-4-[2-(4-phenylphenyl)ethyl]piperidine |
|---|---|
| PubChem CID | 46086776 |
| Molecular Formula | C25H27NO2S |
| Molecular Weight | 405.56 g/mol |
| Exact Mass | 405.18 |
| IUPAC Name | 1-(benzenesulfonyl)-4-[2-(4-phenylphenyl)ethyl]piperidine |
| SMILES | O=S(=O)(c1ccccc1)N1CCC(CCc2ccc(-c3ccccc3)cc2)CC1 |
| InChI | InChI=1S/C25H27NO2S/c27-29(28,25-9-5-2-6-10-25)26-19-17-22(18-20-26)12-11-21-13-15-24(16-14-21)23-7-3-1-4-8-23/h1-10,13-16,22H,11-12,17-20H2 |
| InChIKey | UHRFXHXETUEVGM-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.56 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |