C20H25NO4S2 — CID 90589463
4-(benzenesulfonyl)-1-(4-propylphenyl)sulfonylpiperidine (PubChem CID 90589463) has the molecular formula C20H25NO4S2 and a molecular weight of 407.56 g/mol. Its IUPAC name is 4-(benzenesulfonyl)-1-(4-propylphenyl)sulfonylpiperidine.
| Compound Name | 4-(benzenesulfonyl)-1-(4-propylphenyl)sulfonylpiperidine |
|---|---|
| PubChem CID | 90589463 |
| Molecular Formula | C20H25NO4S2 |
| Molecular Weight | 407.56 g/mol |
| Exact Mass | 407.12 |
| IUPAC Name | 4-(benzenesulfonyl)-1-(4-propylphenyl)sulfonylpiperidine |
| SMILES | CCCc1ccc(S(=O)(=O)N2CCC(S(=O)(=O)c3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C20H25NO4S2/c1-2-6-17-9-11-20(12-10-17)27(24,25)21-15-13-19(14-16-21)26(22,23)18-7-4-3-5-8-18/h3-5,7-12,19H,2,6,13-16H2,1H3 |
| InChIKey | QWABIYDEYMNUFF-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.56 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |