C23H22FNO4S2 — CID 90589531
4-(benzenesulfonyl)-1-[4-(4-fluorophenyl)phenyl]sulfonylpiperidine (PubChem CID 90589531) has the molecular formula C23H22FNO4S2 and a molecular weight of 459.56 g/mol. Its IUPAC name is 4-(benzenesulfonyl)-1-[4-(4-fluorophenyl)phenyl]sulfonylpiperidine.
| Compound Name | 4-(benzenesulfonyl)-1-[4-(4-fluorophenyl)phenyl]sulfonylpiperidine |
|---|---|
| PubChem CID | 90589531 |
| Molecular Formula | C23H22FNO4S2 |
| Molecular Weight | 459.56 g/mol |
| Exact Mass | 459.10 |
| IUPAC Name | 4-(benzenesulfonyl)-1-[4-(4-fluorophenyl)phenyl]sulfonylpiperidine |
| SMILES | O=S(=O)(c1ccccc1)C1CCN(S(=O)(=O)c2ccc(-c3ccc(F)cc3)cc2)CC1 |
| InChI | InChI=1S/C23H22FNO4S2/c24-20-10-6-18(7-11-20)19-8-12-23(13-9-19)31(28,29)25-16-14-22(15-17-25)30(26,27)21-4-2-1-3-5-21/h1-13,22H,14-17H2 |
| InChIKey | RCRWCHPPHJYIOJ-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.56 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |