C22H19ClFNO4S2 — CID 90587938
3-(4-chlorophenyl)sulfonyl-1-[4-(4-fluorophenyl)phenyl]sulfonylpyrrolidine (PubChem CID 90587938) has the molecular formula C22H19ClFNO4S2 and a molecular weight of 479.98 g/mol. Its IUPAC name is 3-(4-chlorophenyl)sulfonyl-1-[4-(4-fluorophenyl)phenyl]sulfonylpyrrolidine.
| Compound Name | 3-(4-chlorophenyl)sulfonyl-1-[4-(4-fluorophenyl)phenyl]sulfonylpyrrolidine |
|---|---|
| PubChem CID | 90587938 |
| Molecular Formula | C22H19ClFNO4S2 |
| Molecular Weight | 479.98 g/mol |
| Exact Mass | 479.04 |
| IUPAC Name | 3-(4-chlorophenyl)sulfonyl-1-[4-(4-fluorophenyl)phenyl]sulfonylpyrrolidine |
| SMILES | O=S(=O)(c1ccc(Cl)cc1)C1CCN(S(=O)(=O)c2ccc(-c3ccc(F)cc3)cc2)C1 |
| InChI | InChI=1S/C22H19ClFNO4S2/c23-18-5-11-20(12-6-18)30(26,27)22-13-14-25(15-22)31(28,29)21-9-3-17(4-10-21)16-1-7-19(24)8-2-16/h1-12,22H,13-15H2 |
| InChIKey | ZHRXYDYTDWUKPO-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.98 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |