C21H26FNO4S2 — CID 90589889
1-(4-tert-butylphenyl)sulfonyl-4-(4-fluorophenyl)sulfonylpiperidine (PubChem CID 90589889) has the molecular formula C21H26FNO4S2 and a molecular weight of 439.57 g/mol. Its IUPAC name is 1-(4-tert-butylphenyl)sulfonyl-4-(4-fluorophenyl)sulfonylpiperidine.
| Compound Name | 1-(4-tert-butylphenyl)sulfonyl-4-(4-fluorophenyl)sulfonylpiperidine |
|---|---|
| PubChem CID | 90589889 |
| Molecular Formula | C21H26FNO4S2 |
| Molecular Weight | 439.57 g/mol |
| Exact Mass | 439.13 |
| IUPAC Name | 1-(4-tert-butylphenyl)sulfonyl-4-(4-fluorophenyl)sulfonylpiperidine |
| SMILES | CC(C)(C)c1ccc(S(=O)(=O)N2CCC(S(=O)(=O)c3ccc(F)cc3)CC2)cc1 |
| InChI | InChI=1S/C21H26FNO4S2/c1-21(2,3)16-4-8-20(9-5-16)29(26,27)23-14-12-19(13-15-23)28(24,25)18-10-6-17(22)7-11-18/h4-11,19H,12-15H2,1-3H3 |
| InChIKey | DTAUSJOWWSYTSZ-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.57 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |