C24H24FNO5S2 — CID 90589932
4-(4-fluorophenyl)sulfonyl-1-[4-(2-methylphenoxy)phenyl]sulfonylpiperidine (PubChem CID 90589932) has the molecular formula C24H24FNO5S2 and a molecular weight of 489.59 g/mol. Its IUPAC name is 4-(4-fluorophenyl)sulfonyl-1-[4-(2-methylphenoxy)phenyl]sulfonylpiperidine.
| Compound Name | 4-(4-fluorophenyl)sulfonyl-1-[4-(2-methylphenoxy)phenyl]sulfonylpiperidine |
|---|---|
| PubChem CID | 90589932 |
| Molecular Formula | C24H24FNO5S2 |
| Molecular Weight | 489.59 g/mol |
| Exact Mass | 489.11 |
| IUPAC Name | 4-(4-fluorophenyl)sulfonyl-1-[4-(2-methylphenoxy)phenyl]sulfonylpiperidine |
| SMILES | Cc1ccccc1Oc1ccc(S(=O)(=O)N2CCC(S(=O)(=O)c3ccc(F)cc3)CC2)cc1 |
| InChI | InChI=1S/C24H24FNO5S2/c1-18-4-2-3-5-24(18)31-20-8-12-23(13-9-20)33(29,30)26-16-14-22(15-17-26)32(27,28)21-10-6-19(25)7-11-21/h2-13,22H,14-17H2,1H3 |
| InChIKey | VZEZVUIHRQACNY-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.59 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |