C19H22FNO5S2 — CID 90589883
4-(4-fluorophenyl)sulfonyl-1-(4-methoxy-2-methylphenyl)sulfonylpiperidine (PubChem CID 90589883) has the molecular formula C19H22FNO5S2 and a molecular weight of 427.52 g/mol. Its IUPAC name is 4-(4-fluorophenyl)sulfonyl-1-(4-methoxy-2-methylphenyl)sulfonylpiperidine.
| Compound Name | 4-(4-fluorophenyl)sulfonyl-1-(4-methoxy-2-methylphenyl)sulfonylpiperidine |
|---|---|
| PubChem CID | 90589883 |
| Molecular Formula | C19H22FNO5S2 |
| Molecular Weight | 427.52 g/mol |
| Exact Mass | 427.09 |
| IUPAC Name | 4-(4-fluorophenyl)sulfonyl-1-(4-methoxy-2-methylphenyl)sulfonylpiperidine |
| SMILES | COc1ccc(S(=O)(=O)N2CCC(S(=O)(=O)c3ccc(F)cc3)CC2)c(C)c1 |
| InChI | InChI=1S/C19H22FNO5S2/c1-14-13-16(26-2)5-8-19(14)28(24,25)21-11-9-18(10-12-21)27(22,23)17-6-3-15(20)4-7-17/h3-8,13,18H,9-12H2,1-2H3 |
| InChIKey | NFCAMJUYZRTQMO-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.52 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |