C19H22FNO3S — CID 171678466
4-(4-fluorophenyl)-1-(4-methoxy-2-methylphenyl)sulfonylpiperidine (PubChem CID 171678466) has the molecular formula C19H22FNO3S and a molecular weight of 363.45 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-1-(4-methoxy-2-methylphenyl)sulfonylpiperidine.
| Compound Name | 4-(4-fluorophenyl)-1-(4-methoxy-2-methylphenyl)sulfonylpiperidine |
|---|---|
| PubChem CID | 171678466 |
| Molecular Formula | C19H22FNO3S |
| Molecular Weight | 363.45 g/mol |
| Exact Mass | 363.13 |
| IUPAC Name | 4-(4-fluorophenyl)-1-(4-methoxy-2-methylphenyl)sulfonylpiperidine |
| SMILES | COc1ccc(S(=O)(=O)N2CCC(c3ccc(F)cc3)CC2)c(C)c1 |
| InChI | InChI=1S/C19H22FNO3S/c1-14-13-18(24-2)7-8-19(14)25(22,23)21-11-9-16(10-12-21)15-3-5-17(20)6-4-15/h3-8,13,16H,9-12H2,1-2H3 |
| InChIKey | FHOSYZIYMQJHOK-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.45 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |