C21H27NO6S2 — CID 90592043
1-(2-ethoxy-5-methylphenyl)sulfonyl-4-(4-methoxyphenyl)sulfonylpiperidine (PubChem CID 90592043) has the molecular formula C21H27NO6S2 and a molecular weight of 453.58 g/mol. Its IUPAC name is 1-(2-ethoxy-5-methylphenyl)sulfonyl-4-(4-methoxyphenyl)sulfonylpiperidine.
| Compound Name | 1-(2-ethoxy-5-methylphenyl)sulfonyl-4-(4-methoxyphenyl)sulfonylpiperidine |
|---|---|
| PubChem CID | 90592043 |
| Molecular Formula | C21H27NO6S2 |
| Molecular Weight | 453.58 g/mol |
| Exact Mass | 453.13 |
| IUPAC Name | 1-(2-ethoxy-5-methylphenyl)sulfonyl-4-(4-methoxyphenyl)sulfonylpiperidine |
| SMILES | CCOc1ccc(C)cc1S(=O)(=O)N1CCC(S(=O)(=O)c2ccc(OC)cc2)CC1 |
| InChI | InChI=1S/C21H27NO6S2/c1-4-28-20-10-5-16(2)15-21(20)30(25,26)22-13-11-19(12-14-22)29(23,24)18-8-6-17(27-3)7-9-18/h5-10,15,19H,4,11-14H2,1-3H3 |
| InChIKey | WNYTVCOXTDOVGH-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.58 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |