C19H22ClNO5S2 — CID 90587901
3-(4-chlorophenyl)sulfonyl-1-(4-ethoxy-3-methylphenyl)sulfonylpyrrolidine (PubChem CID 90587901) has the molecular formula C19H22ClNO5S2 and a molecular weight of 443.97 g/mol. Its IUPAC name is 3-(4-chlorophenyl)sulfonyl-1-(4-ethoxy-3-methylphenyl)sulfonylpyrrolidine.
| Compound Name | 3-(4-chlorophenyl)sulfonyl-1-(4-ethoxy-3-methylphenyl)sulfonylpyrrolidine |
|---|---|
| PubChem CID | 90587901 |
| Molecular Formula | C19H22ClNO5S2 |
| Molecular Weight | 443.97 g/mol |
| Exact Mass | 443.06 |
| IUPAC Name | 3-(4-chlorophenyl)sulfonyl-1-(4-ethoxy-3-methylphenyl)sulfonylpyrrolidine |
| SMILES | CCOc1ccc(S(=O)(=O)N2CCC(S(=O)(=O)c3ccc(Cl)cc3)C2)cc1C |
| InChI | InChI=1S/C19H22ClNO5S2/c1-3-26-19-9-8-17(12-14(19)2)28(24,25)21-11-10-18(13-21)27(22,23)16-6-4-15(20)5-7-16/h4-9,12,18H,3,10-11,13H2,1-2H3 |
| InChIKey | FZOBGNHHEIBHHO-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.97 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |