C18H21NO4S2 — CID 90584959
3-(benzenesulfonyl)-1-(3,4-dimethylphenyl)sulfonylpyrrolidine (PubChem CID 90584959) has the molecular formula C18H21NO4S2 and a molecular weight of 379.50 g/mol. Its IUPAC name is 3-(benzenesulfonyl)-1-(3,4-dimethylphenyl)sulfonylpyrrolidine.
| Compound Name | 3-(benzenesulfonyl)-1-(3,4-dimethylphenyl)sulfonylpyrrolidine |
|---|---|
| PubChem CID | 90584959 |
| Molecular Formula | C18H21NO4S2 |
| Molecular Weight | 379.50 g/mol |
| Exact Mass | 379.09 |
| IUPAC Name | 3-(benzenesulfonyl)-1-(3,4-dimethylphenyl)sulfonylpyrrolidine |
| SMILES | Cc1ccc(S(=O)(=O)N2CCC(S(=O)(=O)c3ccccc3)C2)cc1C |
| InChI | InChI=1S/C18H21NO4S2/c1-14-8-9-17(12-15(14)2)25(22,23)19-11-10-18(13-19)24(20,21)16-6-4-3-5-7-16/h3-9,12,18H,10-11,13H2,1-2H3 |
| InChIKey | LMOVJYNDWRUUPM-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.50 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |