C17H26N2O4S2 — CID 110363746
1-cyclopentylsulfonyl-4-(3,4-dimethylphenyl)sulfonylpiperazine (PubChem CID 110363746) has the molecular formula C17H26N2O4S2 and a molecular weight of 386.54 g/mol. Its IUPAC name is 1-cyclopentylsulfonyl-4-(3,4-dimethylphenyl)sulfonylpiperazine.
| Compound Name | 1-cyclopentylsulfonyl-4-(3,4-dimethylphenyl)sulfonylpiperazine |
|---|---|
| PubChem CID | 110363746 |
| Molecular Formula | C17H26N2O4S2 |
| Molecular Weight | 386.54 g/mol |
| Exact Mass | 386.13 |
| IUPAC Name | 1-cyclopentylsulfonyl-4-(3,4-dimethylphenyl)sulfonylpiperazine |
| SMILES | Cc1ccc(S(=O)(=O)N2CCN(S(=O)(=O)C3CCCC3)CC2)cc1C |
| InChI | InChI=1S/C17H26N2O4S2/c1-14-7-8-17(13-15(14)2)25(22,23)19-11-9-18(10-12-19)24(20,21)16-5-3-4-6-16/h7-8,13,16H,3-6,9-12H2,1-2H3 |
| InChIKey | GFPHEGKCKXTJQK-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.54 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |