C18H26N2O2S — CID 56513505
1-cyclohex-2-en-1-yl-4-(3,4-dimethylphenyl)sulfonylpiperazine (PubChem CID 56513505) has the molecular formula C18H26N2O2S and a molecular weight of 334.49 g/mol. Its IUPAC name is 1-cyclohex-2-en-1-yl-4-(3,4-dimethylphenyl)sulfonylpiperazine.
| Compound Name | 1-cyclohex-2-en-1-yl-4-(3,4-dimethylphenyl)sulfonylpiperazine |
|---|---|
| PubChem CID | 56513505 |
| Molecular Formula | C18H26N2O2S |
| Molecular Weight | 334.49 g/mol |
| Exact Mass | 334.17 |
| IUPAC Name | 1-cyclohex-2-en-1-yl-4-(3,4-dimethylphenyl)sulfonylpiperazine |
| SMILES | Cc1ccc(S(=O)(=O)N2CCN(C3C=CCCC3)CC2)cc1C |
| InChI | InChI=1S/C18H26N2O2S/c1-15-8-9-18(14-16(15)2)23(21,22)20-12-10-19(11-13-20)17-6-4-3-5-7-17/h4,6,8-9,14,17H,3,5,7,10-13H2,1-2H3 |
| InChIKey | RMJLUXPPVHMONP-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.49 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|