C17H20ClF3N2O2S — CID 56512842
1-[4-chloro-3-(trifluoromethyl)phenyl]sulfonyl-4-cyclohex-2-en-1-ylpiperazine (PubChem CID 56512842) has the molecular formula C17H20ClF3N2O2S and a molecular weight of 408.87 g/mol. Its IUPAC name is 1-[4-chloro-3-(trifluoromethyl)phenyl]sulfonyl-4-cyclohex-2-en-1-ylpiperazine.
| Compound Name | 1-[4-chloro-3-(trifluoromethyl)phenyl]sulfonyl-4-cyclohex-2-en-1-ylpiperazine |
|---|---|
| PubChem CID | 56512842 |
| Molecular Formula | C17H20ClF3N2O2S |
| Molecular Weight | 408.87 g/mol |
| Exact Mass | 408.09 |
| IUPAC Name | 1-[4-chloro-3-(trifluoromethyl)phenyl]sulfonyl-4-cyclohex-2-en-1-ylpiperazine |
| SMILES | O=S(=O)(c1ccc(Cl)c(C(F)(F)F)c1)N1CCN(C2C=CCCC2)CC1 |
| InChI | InChI=1S/C17H20ClF3N2O2S/c18-16-7-6-14(12-15(16)17(19,20)21)26(24,25)23-10-8-22(9-11-23)13-4-2-1-3-5-13/h2,4,6-7,12-13H,1,3,5,8-11H2 |
| InChIKey | KJELFRSKMDJEBW-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.87 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|