C13H17Cl2F3N2O2S — CID 17390369
1-[4-chloro-3-(trifluoromethyl)phenyl]sulfonyl-4-ethylpiperazine;hydrochloride (PubChem CID 17390369) has the molecular formula C13H17Cl2F3N2O2S and a molecular weight of 393.26 g/mol. Its IUPAC name is 1-[4-chloro-3-(trifluoromethyl)phenyl]sulfonyl-4-ethylpiperazine;hydrochloride.
| Compound Name | 1-[4-chloro-3-(trifluoromethyl)phenyl]sulfonyl-4-ethylpiperazine;hydrochloride |
|---|---|
| PubChem CID | 17390369 |
| Molecular Formula | C13H17Cl2F3N2O2S |
| Molecular Weight | 393.26 g/mol |
| Exact Mass | 392.03 |
| IUPAC Name | 1-[4-chloro-3-(trifluoromethyl)phenyl]sulfonyl-4-ethylpiperazine;hydrochloride |
| SMILES | CCN1CCN(S(=O)(=O)c2ccc(Cl)c(C(F)(F)F)c2)CC1.Cl |
| InChI | InChI=1S/C13H16ClF3N2O2S.ClH/c1-2-18-5-7-19(8-6-18)22(20,21)10-3-4-12(14)11(9-10)13(15,16)17;/h3-4,9H,2,5-8H2,1H3;1H |
| InChIKey | SYUKKSAVMYOPLW-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.26 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |