C19H19ClF3N3O3S — CID 34686570
4-[[4-[4-chloro-3-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]methyl]benzamide (PubChem CID 34686570) has the molecular formula C19H19ClF3N3O3S and a molecular weight of 461.89 g/mol. Its IUPAC name is 4-[[4-[4-chloro-3-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]methyl]benzamide.
| Compound Name | 4-[[4-[4-chloro-3-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]methyl]benzamide |
|---|---|
| PubChem CID | 34686570 |
| Molecular Formula | C19H19ClF3N3O3S |
| Molecular Weight | 461.89 g/mol |
| Exact Mass | 461.08 |
| IUPAC Name | 4-[[4-[4-chloro-3-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]methyl]benzamide |
| SMILES | NC(=O)c1ccc(CN2CCN(S(=O)(=O)c3ccc(Cl)c(C(F)(F)F)c3)CC2)cc1 |
| InChI | InChI=1S/C19H19ClF3N3O3S/c20-17-6-5-15(11-16(17)19(21,22)23)30(28,29)26-9-7-25(8-10-26)12-13-1-3-14(4-2-13)18(24)27/h1-6,11H,7-10,12H2,(H2,24,27) |
| InChIKey | JUTRUCIZFHUUKH-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 83.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.89 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |