C17H15Cl2F3N2O2S — CID 2462968
1-(3-chlorophenyl)-4-[4-chloro-3-(trifluoromethyl)phenyl]sulfonylpiperazine (PubChem CID 2462968) has the molecular formula C17H15Cl2F3N2O2S and a molecular weight of 439.29 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-4-[4-chloro-3-(trifluoromethyl)phenyl]sulfonylpiperazine.
| Compound Name | 1-(3-chlorophenyl)-4-[4-chloro-3-(trifluoromethyl)phenyl]sulfonylpiperazine |
|---|---|
| PubChem CID | 2462968 |
| Molecular Formula | C17H15Cl2F3N2O2S |
| Molecular Weight | 439.29 g/mol |
| Exact Mass | 438.02 |
| IUPAC Name | 1-(3-chlorophenyl)-4-[4-chloro-3-(trifluoromethyl)phenyl]sulfonylpiperazine |
| SMILES | O=S(=O)(c1ccc(Cl)c(C(F)(F)F)c1)N1CCN(c2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C17H15Cl2F3N2O2S/c18-12-2-1-3-13(10-12)23-6-8-24(9-7-23)27(25,26)14-4-5-16(19)15(11-14)17(20,21)22/h1-5,10-11H,6-9H2 |
| InChIKey | XAKYLZJRMQLINE-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.29 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |