C18H16F6N2O2S — CID 32937290
1-[3-(trifluoromethyl)phenyl]-4-[4-(trifluoromethyl)phenyl]sulfonylpiperazine (PubChem CID 32937290) has the molecular formula C18H16F6N2O2S and a molecular weight of 438.39 g/mol. Its IUPAC name is 1-[3-(trifluoromethyl)phenyl]-4-[4-(trifluoromethyl)phenyl]sulfonylpiperazine.
| Compound Name | 1-[3-(trifluoromethyl)phenyl]-4-[4-(trifluoromethyl)phenyl]sulfonylpiperazine |
|---|---|
| PubChem CID | 32937290 |
| Molecular Formula | C18H16F6N2O2S |
| Molecular Weight | 438.39 g/mol |
| Exact Mass | 438.08 |
| IUPAC Name | 1-[3-(trifluoromethyl)phenyl]-4-[4-(trifluoromethyl)phenyl]sulfonylpiperazine |
| SMILES | O=S(=O)(c1ccc(C(F)(F)F)cc1)N1CCN(c2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C18H16F6N2O2S/c19-17(20,21)13-4-6-16(7-5-13)29(27,28)26-10-8-25(9-11-26)15-3-1-2-14(12-15)18(22,23)24/h1-7,12H,8-11H2 |
| InChIKey | KRTWZVVWQWBLJD-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.39 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |