C17H14Cl3F3N2O2S — CID 3286417
1-(2,4,5-trichlorophenyl)sulfonyl-4-[3-(trifluoromethyl)phenyl]piperazine (PubChem CID 3286417) has the molecular formula C17H14Cl3F3N2O2S and a molecular weight of 473.73 g/mol. Its IUPAC name is 1-(2,4,5-trichlorophenyl)sulfonyl-4-[3-(trifluoromethyl)phenyl]piperazine.
| Compound Name | 1-(2,4,5-trichlorophenyl)sulfonyl-4-[3-(trifluoromethyl)phenyl]piperazine |
|---|---|
| PubChem CID | 3286417 |
| Molecular Formula | C17H14Cl3F3N2O2S |
| Molecular Weight | 473.73 g/mol |
| Exact Mass | 471.98 |
| IUPAC Name | 1-(2,4,5-trichlorophenyl)sulfonyl-4-[3-(trifluoromethyl)phenyl]piperazine |
| SMILES | O=S(=O)(c1cc(Cl)c(Cl)cc1Cl)N1CCN(c2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C17H14Cl3F3N2O2S/c18-13-9-15(20)16(10-14(13)19)28(26,27)25-6-4-24(5-7-25)12-3-1-2-11(8-12)17(21,22)23/h1-3,8-10H,4-7H2 |
| InChIKey | YKFFMVOLEDVLFX-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.73 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|