C17H15Cl2F3N2O3S — CID 3810711
2,4-dichloro-6-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]sulfonylphenol (PubChem CID 3810711) has the molecular formula C17H15Cl2F3N2O3S and a molecular weight of 455.29 g/mol. Its IUPAC name is 2,4-dichloro-6-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]sulfonylphenol.
| Compound Name | 2,4-dichloro-6-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]sulfonylphenol |
|---|---|
| PubChem CID | 3810711 |
| Molecular Formula | C17H15Cl2F3N2O3S |
| Molecular Weight | 455.29 g/mol |
| Exact Mass | 454.01 |
| IUPAC Name | 2,4-dichloro-6-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]sulfonylphenol |
| SMILES | O=S(=O)(c1cc(Cl)cc(Cl)c1O)N1CCN(c2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C17H15Cl2F3N2O3S/c18-12-9-14(19)16(25)15(10-12)28(26,27)24-6-4-23(5-7-24)13-3-1-2-11(8-13)17(20,21)22/h1-3,8-10,25H,4-7H2 |
| InChIKey | QJHFLAIKQYYFTQ-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.29 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfonamide_A(43)', 'substructure': 'N/A'} |
|---|