C19H16F3N3O4S — CID 56561984
5-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]sulfonylisoindole-1,3-dione (PubChem CID 56561984) has the molecular formula C19H16F3N3O4S and a molecular weight of 439.42 g/mol. Its IUPAC name is 5-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]sulfonylisoindole-1,3-dione.
| Compound Name | 5-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]sulfonylisoindole-1,3-dione |
|---|---|
| PubChem CID | 56561984 |
| Molecular Formula | C19H16F3N3O4S |
| Molecular Weight | 439.42 g/mol |
| Exact Mass | 439.08 |
| IUPAC Name | 5-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]sulfonylisoindole-1,3-dione |
| SMILES | O=C1NC(=O)c2cc(S(=O)(=O)N3CCN(c4cccc(C(F)(F)F)c4)CC3)ccc21 |
| InChI | InChI=1S/C19H16F3N3O4S/c20-19(21,22)12-2-1-3-13(10-12)24-6-8-25(9-7-24)30(28,29)14-4-5-15-16(11-14)18(27)23-17(15)26/h1-5,10-11H,6-9H2,(H,23,26,27) |
| InChIKey | RFGXCDRKTIBLNV-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.42 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|