C30H26F3N3O3S — CID 172720889
2-phenyl-N-[4-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]sulfonylphenyl]benzamide (PubChem CID 172720889) has the molecular formula C30H26F3N3O3S and a molecular weight of 565.62 g/mol. Its IUPAC name is 2-phenyl-N-[4-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]sulfonylphenyl]benzamide.
| Compound Name | 2-phenyl-N-[4-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]sulfonylphenyl]benzamide |
|---|---|
| PubChem CID | 172720889 |
| Molecular Formula | C30H26F3N3O3S |
| Molecular Weight | 565.62 g/mol |
| Exact Mass | 565.16 |
| IUPAC Name | 2-phenyl-N-[4-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]sulfonylphenyl]benzamide |
| SMILES | O=C(Nc1ccc(S(=O)(=O)N2CCN(c3cccc(C(F)(F)F)c3)CC2)cc1)c1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C30H26F3N3O3S/c31-30(32,33)23-9-6-10-25(21-23)35-17-19-36(20-18-35)40(38,39)26-15-13-24(14-16-26)34-29(37)28-12-5-4-11-27(28)22-7-2-1-3-8-22/h1-16,21H,17-20H2,(H,34,37) |
| InChIKey | GMQJPFOTNOSPGO-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.62 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |