C27H28ClF3N6O3S — CID 169172461
N-[4-[4-[6-chloro-4-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]sulfonylphenyl]-3-piperazin-1-ylbenzamide (PubChem CID 169172461) has the molecular formula C27H28ClF3N6O3S and a molecular weight of 609.07 g/mol. Its IUPAC name is N-[4-[4-[6-chloro-4-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]sulfonylphenyl]-3-piperazin-1-ylbenzamide.
| Compound Name | N-[4-[4-[6-chloro-4-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]sulfonylphenyl]-3-piperazin-1-ylbenzamide |
|---|---|
| PubChem CID | 169172461 |
| Molecular Formula | C27H28ClF3N6O3S |
| Molecular Weight | 609.07 g/mol |
| Exact Mass | 608.16 |
| IUPAC Name | N-[4-[4-[6-chloro-4-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]sulfonylphenyl]-3-piperazin-1-ylbenzamide |
| SMILES | O=C(Nc1ccc(S(=O)(=O)N2CCN(c3cc(C(F)(F)F)cc(Cl)n3)CC2)cc1)c1cccc(N2CCNCC2)c1 |
| InChI | InChI=1S/C27H28ClF3N6O3S/c28-24-17-20(27(29,30)31)18-25(34-24)36-12-14-37(15-13-36)41(39,40)23-6-4-21(5-7-23)33-26(38)19-2-1-3-22(16-19)35-10-8-32-9-11-35/h1-7,16-18,32H,8-15H2,(H,33,38) |
| InChIKey | RVKGCHOOKKTXLP-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 97.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.07 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|