C31H37ClF3N7O3S — CID 169172427
N-[4-[4-[6-chloro-4-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]sulfonylphenyl]-3-[(3-piperazin-1-ylpropylamino)methyl]benzamide (PubChem CID 169172427) has the molecular formula C31H37ClF3N7O3S and a molecular weight of 680.20 g/mol. Its IUPAC name is N-[4-[4-[6-chloro-4-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]sulfonylphenyl]-3-[(3-piperazin-1-ylpropylamino)methyl]benzamide.
| Compound Name | N-[4-[4-[6-chloro-4-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]sulfonylphenyl]-3-[(3-piperazin-1-ylpropylamino)methyl]benzamide |
|---|---|
| PubChem CID | 169172427 |
| Molecular Formula | C31H37ClF3N7O3S |
| Molecular Weight | 680.20 g/mol |
| Exact Mass | 679.23 |
| IUPAC Name | N-[4-[4-[6-chloro-4-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]sulfonylphenyl]-3-[(3-piperazin-1-ylpropylamino)methyl]benzamide |
| SMILES | O=C(Nc1ccc(S(=O)(=O)N2CCN(c3cc(C(F)(F)F)cc(Cl)n3)CC2)cc1)c1cccc(CNCCCN2CCNCC2)c1 |
| InChI | InChI=1S/C31H37ClF3N7O3S/c32-28-20-25(31(33,34)35)21-29(39-28)41-15-17-42(18-16-41)46(44,45)27-7-5-26(6-8-27)38-30(43)24-4-1-3-23(19-24)22-37-9-2-12-40-13-10-36-11-14-40/h1,3-8,19-21,36-37H,2,9-18,22H2,(H,38,43) |
| InChIKey | LPGIJPORSOYNBM-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 109.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.20 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|