C25H24F3N3O3S — CID 43924856
3-[[4-(benzenesulfonyl)piperazin-1-yl]methyl]-N-[4-(trifluoromethyl)phenyl]benzamide (PubChem CID 43924856) has the molecular formula C25H24F3N3O3S and a molecular weight of 503.55 g/mol. Its IUPAC name is 3-[[4-(benzenesulfonyl)piperazin-1-yl]methyl]-N-[4-(trifluoromethyl)phenyl]benzamide.
| Compound Name | 3-[[4-(benzenesulfonyl)piperazin-1-yl]methyl]-N-[4-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 43924856 |
| Molecular Formula | C25H24F3N3O3S |
| Molecular Weight | 503.55 g/mol |
| Exact Mass | 503.15 |
| IUPAC Name | 3-[[4-(benzenesulfonyl)piperazin-1-yl]methyl]-N-[4-(trifluoromethyl)phenyl]benzamide |
| SMILES | O=C(Nc1ccc(C(F)(F)F)cc1)c1cccc(CN2CCN(S(=O)(=O)c3ccccc3)CC2)c1 |
| InChI | InChI=1S/C25H24F3N3O3S/c26-25(27,28)21-9-11-22(12-10-21)29-24(32)20-6-4-5-19(17-20)18-30-13-15-31(16-14-30)35(33,34)23-7-2-1-3-8-23/h1-12,17H,13-16,18H2,(H,29,32) |
| InChIKey | QHDCTEQFYALATR-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.55 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |