C25H27N3O3S2 — CID 43922873
3-[[4-(benzenesulfonyl)piperazin-1-yl]methyl]-N-(3-methylsulfanylphenyl)benzamide (PubChem CID 43922873) has the molecular formula C25H27N3O3S2 and a molecular weight of 481.64 g/mol. Its IUPAC name is 3-[[4-(benzenesulfonyl)piperazin-1-yl]methyl]-N-(3-methylsulfanylphenyl)benzamide.
| Compound Name | 3-[[4-(benzenesulfonyl)piperazin-1-yl]methyl]-N-(3-methylsulfanylphenyl)benzamide |
|---|---|
| PubChem CID | 43922873 |
| Molecular Formula | C25H27N3O3S2 |
| Molecular Weight | 481.64 g/mol |
| Exact Mass | 481.15 |
| IUPAC Name | 3-[[4-(benzenesulfonyl)piperazin-1-yl]methyl]-N-(3-methylsulfanylphenyl)benzamide |
| SMILES | CSc1cccc(NC(=O)c2cccc(CN3CCN(S(=O)(=O)c4ccccc4)CC3)c2)c1 |
| InChI | InChI=1S/C25H27N3O3S2/c1-32-23-10-6-9-22(18-23)26-25(29)21-8-5-7-20(17-21)19-27-13-15-28(16-14-27)33(30,31)24-11-3-2-4-12-24/h2-12,17-18H,13-16,19H2,1H3,(H,26,29) |
| InChIKey | LCHVGORDMHURJZ-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.64 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |