C24H23F2N3O3S — CID 43923148
3-[[4-(benzenesulfonyl)piperazin-1-yl]methyl]-N-(2,4-difluorophenyl)benzamide (PubChem CID 43923148) has the molecular formula C24H23F2N3O3S and a molecular weight of 471.53 g/mol. Its IUPAC name is 3-[[4-(benzenesulfonyl)piperazin-1-yl]methyl]-N-(2,4-difluorophenyl)benzamide.
| Compound Name | 3-[[4-(benzenesulfonyl)piperazin-1-yl]methyl]-N-(2,4-difluorophenyl)benzamide |
|---|---|
| PubChem CID | 43923148 |
| Molecular Formula | C24H23F2N3O3S |
| Molecular Weight | 471.53 g/mol |
| Exact Mass | 471.14 |
| IUPAC Name | 3-[[4-(benzenesulfonyl)piperazin-1-yl]methyl]-N-(2,4-difluorophenyl)benzamide |
| SMILES | O=C(Nc1ccc(F)cc1F)c1cccc(CN2CCN(S(=O)(=O)c3ccccc3)CC2)c1 |
| InChI | InChI=1S/C24H23F2N3O3S/c25-20-9-10-23(22(26)16-20)27-24(30)19-6-4-5-18(15-19)17-28-11-13-29(14-12-28)33(31,32)21-7-2-1-3-8-21/h1-10,15-16H,11-14,17H2,(H,27,30) |
| InChIKey | XQJLJZLXQNURQW-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.53 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |