C24H23ClFN3O3S — CID 18892684
N-[4-(4-benzylpiperazin-1-yl)sulfonyl-2-fluorophenyl]-4-chlorobenzamide (PubChem CID 18892684) has the molecular formula C24H23ClFN3O3S and a molecular weight of 487.98 g/mol. Its IUPAC name is N-[4-(4-benzylpiperazin-1-yl)sulfonyl-2-fluorophenyl]-4-chlorobenzamide.
| Compound Name | N-[4-(4-benzylpiperazin-1-yl)sulfonyl-2-fluorophenyl]-4-chlorobenzamide |
|---|---|
| PubChem CID | 18892684 |
| Molecular Formula | C24H23ClFN3O3S |
| Molecular Weight | 487.98 g/mol |
| Exact Mass | 487.11 |
| IUPAC Name | N-[4-(4-benzylpiperazin-1-yl)sulfonyl-2-fluorophenyl]-4-chlorobenzamide |
| SMILES | O=C(Nc1ccc(S(=O)(=O)N2CCN(Cc3ccccc3)CC2)cc1F)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H23ClFN3O3S/c25-20-8-6-19(7-9-20)24(30)27-23-11-10-21(16-22(23)26)33(31,32)29-14-12-28(13-15-29)17-18-4-2-1-3-5-18/h1-11,16H,12-15,17H2,(H,27,30) |
| InChIKey | IXCCUGGECVDKRV-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.98 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |