C30H29N3O4S — CID 38099477
3-[[4-(benzenesulfonyl)piperazin-1-yl]methyl]-N-(2-phenoxyphenyl)benzamide (PubChem CID 38099477) has the molecular formula C30H29N3O4S and a molecular weight of 527.65 g/mol. Its IUPAC name is 3-[[4-(benzenesulfonyl)piperazin-1-yl]methyl]-N-(2-phenoxyphenyl)benzamide.
| Compound Name | 3-[[4-(benzenesulfonyl)piperazin-1-yl]methyl]-N-(2-phenoxyphenyl)benzamide |
|---|---|
| PubChem CID | 38099477 |
| Molecular Formula | C30H29N3O4S |
| Molecular Weight | 527.65 g/mol |
| Exact Mass | 527.19 |
| IUPAC Name | 3-[[4-(benzenesulfonyl)piperazin-1-yl]methyl]-N-(2-phenoxyphenyl)benzamide |
| SMILES | O=C(Nc1ccccc1Oc1ccccc1)c1cccc(CN2CCN(S(=O)(=O)c3ccccc3)CC2)c1 |
| InChI | InChI=1S/C30H29N3O4S/c34-30(31-28-16-7-8-17-29(28)37-26-12-3-1-4-13-26)25-11-9-10-24(22-25)23-32-18-20-33(21-19-32)38(35,36)27-14-5-2-6-15-27/h1-17,22H,18-21,23H2,(H,31,34) |
| InChIKey | YLEWAMRDBNHHDH-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.65 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |