C25H34N4O5S2 — CID 43925181
N-[4-(azepan-1-ylsulfonyl)phenyl]-3-[(4-methylsulfonylpiperazin-1-yl)methyl]benzamide (PubChem CID 43925181) has the molecular formula C25H34N4O5S2 and a molecular weight of 534.70 g/mol. Its IUPAC name is N-[4-(azepan-1-ylsulfonyl)phenyl]-3-[(4-methylsulfonylpiperazin-1-yl)methyl]benzamide.
| Compound Name | N-[4-(azepan-1-ylsulfonyl)phenyl]-3-[(4-methylsulfonylpiperazin-1-yl)methyl]benzamide |
|---|---|
| PubChem CID | 43925181 |
| Molecular Formula | C25H34N4O5S2 |
| Molecular Weight | 534.70 g/mol |
| Exact Mass | 534.20 |
| IUPAC Name | N-[4-(azepan-1-ylsulfonyl)phenyl]-3-[(4-methylsulfonylpiperazin-1-yl)methyl]benzamide |
| SMILES | CS(=O)(=O)N1CCN(Cc2cccc(C(=O)Nc3ccc(S(=O)(=O)N4CCCCCC4)cc3)c2)CC1 |
| InChI | InChI=1S/C25H34N4O5S2/c1-35(31,32)28-17-15-27(16-18-28)20-21-7-6-8-22(19-21)25(30)26-23-9-11-24(12-10-23)36(33,34)29-13-4-2-3-5-14-29/h6-12,19H,2-5,13-18,20H2,1H3,(H,26,30) |
| InChIKey | JLFXKEPNKMPEKA-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 107.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.70 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |