C20H23N3O5S — CID 43921468
N-(1,3-benzodioxol-5-yl)-3-[(4-methylsulfonylpiperazin-1-yl)methyl]benzamide (PubChem CID 43921468) has the molecular formula C20H23N3O5S and a molecular weight of 417.49 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-3-[(4-methylsulfonylpiperazin-1-yl)methyl]benzamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-3-[(4-methylsulfonylpiperazin-1-yl)methyl]benzamide |
|---|---|
| PubChem CID | 43921468 |
| Molecular Formula | C20H23N3O5S |
| Molecular Weight | 417.49 g/mol |
| Exact Mass | 417.14 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-3-[(4-methylsulfonylpiperazin-1-yl)methyl]benzamide |
| SMILES | CS(=O)(=O)N1CCN(Cc2cccc(C(=O)Nc3ccc4c(c3)OCO4)c2)CC1 |
| InChI | InChI=1S/C20H23N3O5S/c1-29(25,26)23-9-7-22(8-10-23)13-15-3-2-4-16(11-15)20(24)21-17-5-6-18-19(12-17)28-14-27-18/h2-6,11-12H,7-10,13-14H2,1H3,(H,21,24) |
| InChIKey | LTPYIJMBYIDXKF-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.49 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |