C20H24BrN3O3S — CID 43919553
N-(4-bromophenyl)-3-[(4-ethylsulfonylpiperazin-1-yl)methyl]benzamide (PubChem CID 43919553) has the molecular formula C20H24BrN3O3S and a molecular weight of 466.40 g/mol. Its IUPAC name is N-(4-bromophenyl)-3-[(4-ethylsulfonylpiperazin-1-yl)methyl]benzamide.
| Compound Name | N-(4-bromophenyl)-3-[(4-ethylsulfonylpiperazin-1-yl)methyl]benzamide |
|---|---|
| PubChem CID | 43919553 |
| Molecular Formula | C20H24BrN3O3S |
| Molecular Weight | 466.40 g/mol |
| Exact Mass | 465.07 |
| IUPAC Name | N-(4-bromophenyl)-3-[(4-ethylsulfonylpiperazin-1-yl)methyl]benzamide |
| SMILES | CCS(=O)(=O)N1CCN(Cc2cccc(C(=O)Nc3ccc(Br)cc3)c2)CC1 |
| InChI | InChI=1S/C20H24BrN3O3S/c1-2-28(26,27)24-12-10-23(11-13-24)15-16-4-3-5-17(14-16)20(25)22-19-8-6-18(21)7-9-19/h3-9,14H,2,10-13,15H2,1H3,(H,22,25) |
| InChIKey | UCBKGNAZCJOFLO-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.40 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |