C18H29N3O3S — CID 43918442
N-butan-2-yl-3-[(4-ethylsulfonylpiperazin-1-yl)methyl]benzamide (PubChem CID 43918442) has the molecular formula C18H29N3O3S and a molecular weight of 367.52 g/mol. Its IUPAC name is N-butan-2-yl-3-[(4-ethylsulfonylpiperazin-1-yl)methyl]benzamide.
| Compound Name | N-butan-2-yl-3-[(4-ethylsulfonylpiperazin-1-yl)methyl]benzamide |
|---|---|
| PubChem CID | 43918442 |
| Molecular Formula | C18H29N3O3S |
| Molecular Weight | 367.52 g/mol |
| Exact Mass | 367.19 |
| IUPAC Name | N-butan-2-yl-3-[(4-ethylsulfonylpiperazin-1-yl)methyl]benzamide |
| SMILES | CCC(C)NC(=O)c1cccc(CN2CCN(S(=O)(=O)CC)CC2)c1 |
| InChI | InChI=1S/C18H29N3O3S/c1-4-15(3)19-18(22)17-8-6-7-16(13-17)14-20-9-11-21(12-10-20)25(23,24)5-2/h6-8,13,15H,4-5,9-12,14H2,1-3H3,(H,19,22) |
| InChIKey | RIFFAYYVJXDPHL-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.52 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |