C21H26ClN3O4S — CID 43921508
N-(5-chloro-2-methoxyphenyl)-3-[(4-ethylsulfonylpiperazin-1-yl)methyl]benzamide (PubChem CID 43921508) has the molecular formula C21H26ClN3O4S and a molecular weight of 451.98 g/mol. Its IUPAC name is N-(5-chloro-2-methoxyphenyl)-3-[(4-ethylsulfonylpiperazin-1-yl)methyl]benzamide.
| Compound Name | N-(5-chloro-2-methoxyphenyl)-3-[(4-ethylsulfonylpiperazin-1-yl)methyl]benzamide |
|---|---|
| PubChem CID | 43921508 |
| Molecular Formula | C21H26ClN3O4S |
| Molecular Weight | 451.98 g/mol |
| Exact Mass | 451.13 |
| IUPAC Name | N-(5-chloro-2-methoxyphenyl)-3-[(4-ethylsulfonylpiperazin-1-yl)methyl]benzamide |
| SMILES | CCS(=O)(=O)N1CCN(Cc2cccc(C(=O)Nc3cc(Cl)ccc3OC)c2)CC1 |
| InChI | InChI=1S/C21H26ClN3O4S/c1-3-30(27,28)25-11-9-24(10-12-25)15-16-5-4-6-17(13-16)21(26)23-19-14-18(22)7-8-20(19)29-2/h4-8,13-14H,3,9-12,15H2,1-2H3,(H,23,26) |
| InChIKey | WFZAAQDWMVZOJH-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.98 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |