C20H24N2O4 — CID 28572616
N-(2,5-dimethoxyphenyl)-3-(morpholin-4-ylmethyl)benzamide (PubChem CID 28572616) has the molecular formula C20H24N2O4 and a molecular weight of 356.42 g/mol. Its IUPAC name is N-(2,5-dimethoxyphenyl)-3-(morpholin-4-ylmethyl)benzamide.
| Compound Name | N-(2,5-dimethoxyphenyl)-3-(morpholin-4-ylmethyl)benzamide |
|---|---|
| PubChem CID | 28572616 |
| Molecular Formula | C20H24N2O4 |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.17 |
| IUPAC Name | N-(2,5-dimethoxyphenyl)-3-(morpholin-4-ylmethyl)benzamide |
| SMILES | COc1ccc(OC)c(NC(=O)c2cccc(CN3CCOCC3)c2)c1 |
| InChI | InChI=1S/C20H24N2O4/c1-24-17-6-7-19(25-2)18(13-17)21-20(23)16-5-3-4-15(12-16)14-22-8-10-26-11-9-22/h3-7,12-13H,8-11,14H2,1-2H3,(H,21,23) |
| InChIKey | ZEWYOEHCUBQYHZ-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |