C22H28N2O3 — CID 43920068
N-(2,5-dimethoxyphenyl)-4-[(4-methylpiperidin-1-yl)methyl]benzamide (PubChem CID 43920068) has the molecular formula C22H28N2O3 and a molecular weight of 368.48 g/mol. Its IUPAC name is N-(2,5-dimethoxyphenyl)-4-[(4-methylpiperidin-1-yl)methyl]benzamide.
| Compound Name | N-(2,5-dimethoxyphenyl)-4-[(4-methylpiperidin-1-yl)methyl]benzamide |
|---|---|
| PubChem CID | 43920068 |
| Molecular Formula | C22H28N2O3 |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.21 |
| IUPAC Name | N-(2,5-dimethoxyphenyl)-4-[(4-methylpiperidin-1-yl)methyl]benzamide |
| SMILES | COc1ccc(OC)c(NC(=O)c2ccc(CN3CCC(C)CC3)cc2)c1 |
| InChI | InChI=1S/C22H28N2O3/c1-16-10-12-24(13-11-16)15-17-4-6-18(7-5-17)22(25)23-20-14-19(26-2)8-9-21(20)27-3/h4-9,14,16H,10-13,15H2,1-3H3,(H,23,25) |
| InChIKey | RYIZGYAXOKEWAF-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |