methyl 4-[(2,5-dimethoxyphenyl)carbamoyl]benzoate

C17H17NO5 — CID 16585566

IUPACmethyl 4-[(2,5-dimethoxyphenyl)carbamoyl]benzoate
SMILESCOC(=O)c1ccc(C(=O)Nc2cc(OC)ccc2OC)cc1
InChIInChI=1S/C17H17NO5/c1-21-13-8-9-15(22-2)14(10-13)18-16(19)11-4-6-12(7-5-11)17(20)23-3/h4-10H,1-3H3,(H,18,19)
InChIKeyNDFQIDPLJVNEBW-UHFFFAOYSA-N
MW315.33 g/mol
LogP2.74
Rot. Bonds5

About methyl 4-[(2,5-dimethoxyphenyl)carbamoyl]benzoate

methyl 4-[(2,5-dimethoxyphenyl)carbamoyl]benzoate (PubChem CID 16585566) has the molecular formula C17H17NO5 and a molecular weight of 315.33 g/mol. Its IUPAC name is methyl 4-[(2,5-dimethoxyphenyl)carbamoyl]benzoate.

Molecular Properties

Compound Namemethyl 4-[(2,5-dimethoxyphenyl)carbamoyl]benzoate
PubChem CID16585566
Molecular FormulaC17H17NO5
Molecular Weight315.33 g/mol
Exact Mass315.11
IUPAC Namemethyl 4-[(2,5-dimethoxyphenyl)carbamoyl]benzoate
SMILESCOC(=O)c1ccc(C(=O)Nc2cc(OC)ccc2OC)cc1
InChIInChI=1S/C17H17NO5/c1-21-13-8-9-15(22-2)14(10-13)18-16(19)11-4-6-12(7-5-11)17(20)23-3/h4-10H,1-3H3,(H,18,19)
InChIKeyNDFQIDPLJVNEBW-UHFFFAOYSA-N
XLogP2.74
TPSA73.86 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds5
Heavy Atoms23
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500315.33
LogP ≤ 52.74
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze methyl 4-[(2,5-dimethoxyphenyl)carbamoyl]benzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 4-[(2,5-dimethoxyphenyl)carbamoyl]benzoate?
The IUPAC name of methyl 4-[(2,5-dimethoxyphenyl)carbamoyl]benzoate (CID 16585566) is methyl 4-[(2,5-dimethoxyphenyl)carbamoyl]benzoate.
What is the SMILES notation for methyl 4-[(2,5-dimethoxyphenyl)carbamoyl]benzoate?
The canonical SMILES for methyl 4-[(2,5-dimethoxyphenyl)carbamoyl]benzoate is COC(=O)c1ccc(C(=O)Nc2cc(OC)ccc2OC)cc1.
What is the InChIKey of methyl 4-[(2,5-dimethoxyphenyl)carbamoyl]benzoate?
The InChIKey is NDFQIDPLJVNEBW-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17NO5/c1-21-13-8-9-15(22-2)14(10-13)18-16(19)11-4-6-12(7-5-11)17(20)23-3/h4-10H,1-3H3,(H,18,19).
What are the key properties of methyl 4-[(2,5-dimethoxyphenyl)carbamoyl]benzoate?
methyl 4-[(2,5-dimethoxyphenyl)carbamoyl]benzoate has a molecular weight of 315.33 g/mol, XLogP of 2.74, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-[(2,5-dimethoxyphenyl)carbamoyl]benzoate is sourced from PubChem (CID 16585566), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).